Name | Azodicarboxylic Bismorpholide |
Synonyms | NSC 356022 Azodicarboxylic Dimorpholide AZODICARBOXYLIC DIMORPHOLIDE AZODICARBOXYLIC BISMORPHOLIDE Azodicarboxylic Bismorpholide 4,4'-Azodicarbonylbis(morpholine) Diazene-1,2-diylbis(morpholinomethanone) diazene-1,2-diylbis(morpholin-4-ylmethanone) 4,4'-[(E)-diazene-1,2-diyldicarbonyl]dimorpholine Methanone,1,1'-(1,2-diazenediyl)bis[1-(4-morpholinyl)- |
CAS | 10465-82-4 |
EINECS | 418-690-0 |
InChI | InChI=1/C10H16N4O4/c15-9(13-1-5-17-6-2-13)11-12-10(16)14-3-7-18-8-4-14/h1-8H2/b12-11+ |
Molecular Formula | C10H16N4O4 |
Molar Mass | 256.26 |
Density | 1.46±0.1 g/cm3(Predicted) |
Melting Point | 141-143 °C |
Boling Point | 397.6±52.0 °C(Predicted) |
Flash Point | 194.3°C |
Vapor Presure | 1.56E-06mmHg at 25°C |
BRN | 1013753 |
pKa | -0.97±0.20(Predicted) |
Storage Condition | Sealed in dry,Room Temperature |
Refractive Index | 1.626 |
MDL | MFCD00043006 |
Physical and Chemical Properties | WGK Germany:3 |
Use | Reagents for the synthesis of symmetric and asymmetric disulfides in polar solvents such as water |
Safety Description | S22 - Do not breathe dust. S24/25 - Avoid contact with skin and eyes. |
WGK Germany | 3 |
Use | Reagents for the synthesis of symmetric and asymmetric disulfides in polar solvents (such as water) |